ChemNet > CAS > 1878-49-5 (2-Methylphenoxy)acetic acid
1878-49-5 (2-Methylphenoxy)acetic acid
Naam product |
(2-Methylphenoxy)acetic acid |
Synoniemen |
2-Methylphenoxyacetic acid; (o-Tolyloxy)-acetic acid; (2-methylphenoxy)acetate |
MF |
C9H9O3 |
Molecuulgewicht |
165.1665 |
InChI |
InChI=1/C9H10O3/c1-7-4-2-3-5-8(7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
CAS-nummer |
1878-49-5 |
EINECS |
217-517-4 |
Moleculaire Structuur |
|
Smeltpunt |
152-154℃ |
Kookpunt |
288.4°C at 760 mmHg |
Vlampunt |
115.7°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|