ChemNet > CAS > 216393-63-4 5-Isopropyl-2-methoxybenzeneboronic acid
216393-63-4 5-Isopropyl-2-methoxybenzeneboronic acid
| Naam product |
5-Isopropyl-2-methoxybenzeneboronic acid |
| Synoniemen |
(5-Isopropyl-2-methoxyphenyl)boronic acid; boronic acid, B-[2-methoxy-5-(1-methylethyl)phenyl]-; [2-methoxy-5-(1-methylethyl)phenyl]boronic acid; 5-Isopropyl-2-methoxyphenylboronic acid |
| MF |
C10H15BO3 |
| Molecuulgewicht |
194.0353 |
| InChI |
InChI=1/C10H15BO3/c1-7(2)8-4-5-10(14-3)9(6-8)11(12)13/h4-7,12-13H,1-3H3 |
| CAS-nummer |
216393-63-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.08g/cm3 |
| Kookpunt |
350°C at 760 mmHg |
| Brekingsindex |
1.509 |
| Vlampunt |
165.5°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
