ChemNet > CAS > 22409-91-2 ethyl 3-phenoxypropionate
22409-91-2 ethyl 3-phenoxypropionate
Naam product |
ethyl 3-phenoxypropionate |
Engelse naam |
ethyl 3-phenoxypropionate; 3-Phenoxypropionic acid ethyl ester; ethyl 3-phenoxypropanoate |
MF |
C11H14O3 |
Molecuulgewicht |
194.2271 |
InChI |
InChI=1/C11H14O3/c1-2-13-11(12)8-9-14-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
CAS-nummer |
22409-91-2 |
Moleculaire Structuur |
|
Dichtheid |
1.061g/cm3 |
Smeltpunt |
22-24℃ |
Kookpunt |
287.6°C at 760 mmHg |
Brekingsindex |
1.493 |
Vlampunt |
116°C |
Dampdruk |
0.00246mmHg at 25°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|