ChemNet > CAS > 22409-91-2 ethyl 3-phenoxypropionate
22409-91-2 ethyl 3-phenoxypropionate
| Naam product |
ethyl 3-phenoxypropionate |
| Synoniemen |
3-Phenoxypropionic acid ethyl ester; ethyl 3-phenoxypropanoate |
| MF |
C11H14O3 |
| Molecuulgewicht |
194.2271 |
| InChI |
InChI=1/C11H14O3/c1-2-13-11(12)8-9-14-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| CAS-nummer |
22409-91-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.061g/cm3 |
| Smeltpunt |
22-24℃ |
| Kookpunt |
287.6°C at 760 mmHg |
| Brekingsindex |
1.493 |
| Vlampunt |
116°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
