ChemNet > CAS > 225104-76-7 3-Chloro-2,6-difluorobenzoic acid
225104-76-7 3-Chloro-2,6-difluorobenzoic acid
Naam product |
3-Chloro-2,6-difluorobenzoic acid |
Engelse naam |
3-Chloro-2,6-difluorobenzoic acid; |
MF |
C7H3ClF2O2 |
Molecuulgewicht |
192.5473 |
InChI |
InChI=1/C7H3ClF2O2/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2H,(H,11,12) |
CAS-nummer |
225104-76-7 |
Moleculaire Structuur |
|
Dichtheid |
1.573g/cm3 |
Kookpunt |
264.5°C at 760 mmHg |
Brekingsindex |
1.534 |
Vlampunt |
113.8°C |
Dampdruk |
0.00484mmHg at 25°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|