ChemNet > CAS > 25115-74-6 4-Cyano-4-phenylcyclohexanone
25115-74-6 4-Cyano-4-phenylcyclohexanone
Naam product |
4-Cyano-4-phenylcyclohexanone |
Engelse naam |
4-Cyano-4-phenylcyclohexanone; 4-oxo-1-phenylcyclohexanenitrile; 4-oxo-1-phenylcyclohexanecarbonitrile |
MF |
C13H13NO |
Molecuulgewicht |
199.2484 |
InChI |
InChI=1/C13H13NO/c14-10-13(8-6-12(15)7-9-13)11-4-2-1-3-5-11/h1-5H,6-9H2 |
CAS-nummer |
25115-74-6 |
EINECS |
246-631-7 |
Moleculaire Structuur |
|
Dichtheid |
1.12g/cm3 |
Smeltpunt |
114-119℃ |
Kookpunt |
378.6°C at 760 mmHg |
Brekingsindex |
1.557 |
Vlampunt |
182.8°C |
Dampdruk |
6.22E-06mmHg at 25°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|