ChemNet > CAS > 4815-24-1 Ethyl 2-amino-4,5-dimethylthiophene-3-carboxylate
4815-24-1 Ethyl 2-amino-4,5-dimethylthiophene-3-carboxylate
Naam product |
Ethyl 2-amino-4,5-dimethylthiophene-3-carboxylate |
Synoniemen |
Ethyl 2-amino-4,5-dimethyl3-thenoate; NSC 86908 |
MF |
C9H13NO2S |
Molecuulgewicht |
199.27 |
InChI |
InChI=1/C9H13NO2S/c1-4-12-9(11)7-5(2)6(3)13-8(7)10/h4,10H2,1-3H3 |
CAS-nummer |
4815-24-1 |
EINECS |
225-387-5 |
Moleculaire Structuur |
|
Dichtheid |
1.185g/cm3 |
Smeltpunt |
88℃ |
Kookpunt |
302.9°C at 760 mmHg |
Brekingsindex |
1.567 |
Vlampunt |
137°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|