ChemNet > CAS > 4938-52-7 1-Hepten-3-ol
4938-52-7 1-Hepten-3-ol
Naam product |
1-Hepten-3-ol |
Synoniemen |
n-Butyl vinyl carbinol; hept-1-en-3-ol; (3S)-hept-1-en-3-ol |
MF |
C7H14O |
Molecuulgewicht |
114.1855 |
InChI |
InChI=1/C7H14O/c1-3-5-6-7(8)4-2/h4,7-8H,2-3,5-6H2,1H3/t7-/m1/s1 |
CAS-nummer |
4938-52-7 |
EINECS |
225-579-9 |
Moleculaire Structuur |
|
Dichtheid |
0.833g/cm3 |
Kookpunt |
154.5°C at 760 mmHg |
Brekingsindex |
1.434 |
Vlampunt |
48.8°C |
Gevaarsymbolen |
|
Risico-codes |
R10:Flammable.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|