5344-88-7 Benzil monohydrazone
Naam product |
Benzil monohydrazone |
Engelse naam |
Benzil monohydrazone; hydrazonodeoxybenzoin; (1E)-1,2-diphenylethane-1,2-dione 1-hydrazone
; 2-hydrazinylidene-1,2-diphenylethanone; 1-[(4-chlorobenzyl)sulfinyl]-3-phenoxypropan-2-ol; (2Z)-2-hydrazono-1,2-diphenylethanone; (2E)-2-hydrazono-1,2-diphenylethanone |
MF |
C14H12N2O |
Molecuulgewicht |
224.2579 |
InChI |
InChI=1/C14H12N2O/c15-16-13(11-7-3-1-4-8-11)14(17)12-9-5-2-6-10-12/h1-10H,15H2/b16-13+ |
CAS-nummer |
5344-88-7 |
EINECS |
226-292-1 |
Moleculaire Structuur |
|
Dichtheid |
1.12g/cm3 |
Smeltpunt |
147-151℃ |
Kookpunt |
390.7°C at 760 mmHg |
Brekingsindex |
1.594 |
Vlampunt |
190.1°C |
Dampdruk |
2.6E-06mmHg at 25°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|