ChemNet > CAS > 5814-06-2 2,4-Dichlorobenzhydrazide
5814-06-2 2,4-Dichlorobenzhydrazide
Naam product |
2,4-Dichlorobenzhydrazide |
Engelse naam |
2,4-Dichlorobenzhydrazide; AKOS BBS-00004605; 2,4-DICHLOROBENZOIC ACID HYDRAZIDE; SPECS AG-205/15424553; 2,4-DICHLOROBENZOIC HYDRAZIDE; 2,4-Dichlorobenzhydrazide,97%; 2,4-DICHLOROBENZOHYDRAZIDE; 2,4-DICHLOROBENZHYDRAZIDE 97% |
MF |
C7H6Cl2N2O |
Molecuulgewicht |
205.0413 |
InChI |
InChI=1/C7H6Cl2N2O/c8-4-1-2-5(6(9)3-4)7(12)11-10/h1-3H,10H2,(H,11,12) |
CAS-nummer |
5814-06-2 |
Moleculaire Structuur |
|
Dichtheid |
1.455g/cm3 |
Brekingsindex |
1.605 |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|