591-08-2 N-Acetylthiourea
| Naam product |
N-Acetylthiourea |
| Engelse naam |
N-Acetylthiourea; N-Acetylthiourea,98%; N-carbamothioylacetamide |
| MF |
C3H6N2OS |
| Molecuulgewicht |
118.1575 |
| InChI |
InChI=1/C3H6N2OS/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) |
| CAS-nummer |
591-08-2 |
| EINECS |
209-699-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.275g/cm3 |
| Smeltpunt |
166-168℃ |
| Kookpunt |
208.6°C at 760 mmHg |
| Brekingsindex |
1.569 |
| Vlampunt |
80°C |
| Dampdruk |
0.212mmHg at 25°C |
| Gevaarsymbolen |
T:Toxic;
|
| Risico-codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|