604-44-4 4-Chloro-1-naphthol
| Naam product |
4-Chloro-1-naphthol |
| Engelse naam |
4-Chloro-1-naphthol;1-Chloro-4-hydroxynaphthalene; 4-Chloro-alpha-naphthol; NSC 44345; 1-Naphthalenol, 4-chloro-; 1-Naphthol, 4-chloro- (8CI); 4-chloronaphthalen-1-ol |
| MF |
C10H7ClO |
| Molecuulgewicht |
178.615 |
| InChI |
InChI=1/C10H7ClO/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6,12H |
| CAS-nummer |
604-44-4 |
| EINECS |
210-068-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.333g/cm3 |
| Smeltpunt |
117-120℃ |
| Kookpunt |
332.1°C at 760 mmHg |
| Brekingsindex |
1.684 |
| Vlampunt |
154.6°C |
| Dampdruk |
7.74E-05mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|