613-80-9 di-2-naphthyl ether
Naam product |
di-2-naphthyl ether |
Engelse naam |
di-2-naphthyl ether; Dinaphthylether; 2,2-Dinaphthyl ether; 2-Naphthyl ether; 2,2'-oxydinaphthalene |
MF |
C20H14O |
Molecuulgewicht |
270.3246 |
InChI |
InChI=1/C20H14O/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14H |
CAS-nummer |
613-80-9 |
EINECS |
210-356-0 |
Moleculaire Structuur |
|
Dichtheid |
1.184g/cm3 |
Kookpunt |
449.9°C at 760 mmHg |
Brekingsindex |
1.701 |
Vlampunt |
226.1°C |
Dampdruk |
7.3E-08mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|