6228-73-5 Cyclopropanecarboxamide
Naam product |
Cyclopropanecarboxamide |
Engelse naam |
Cyclopropanecarboxamide; AI3-62011; Carbamoylcyclopropane; Cyclopropylcarboxamide; NSC 402033 |
MF |
C4H7NO |
Molecuulgewicht |
85.1045 |
InChI |
InChI=1/C4H7NO/c5-4(6)3-1-2-3/h3H,1-2H2,(H2,5,6) |
CAS-nummer |
6228-73-5 |
EINECS |
228-332-3 |
Moleculaire Structuur |
|
Dichtheid |
1.187g/cm3 |
Kookpunt |
248.5°C at 760 mmHg |
Brekingsindex |
1.524 |
Vlampunt |
104.1°C |
Dampdruk |
0.0242mmHg at 25°C |
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|