ChemNet > CAS > 80866-76-8 3-Methyl-2-nitrobenzyl alcohol
80866-76-8 3-Methyl-2-nitrobenzyl alcohol
Naam product |
3-Methyl-2-nitrobenzyl alcohol |
Engelse naam |
3-Methyl-2-nitrobenzyl alcohol;(3-methyl-2-nitrophenyl)methanol |
MF |
C8H9NO3 |
Molecuulgewicht |
167.162 |
InChI |
InChI=1/C8H9NO3/c1-6-3-2-4-7(5-10)8(6)9(11)12/h2-4,10H,5H2,1H3 |
CAS-nummer |
80866-76-8 |
EINECS |
279-579-9 |
Moleculaire Structuur |
|
Dichtheid |
1.272g/cm3 |
Smeltpunt |
42-47℃ |
Kookpunt |
293°C at 760 mmHg |
Brekingsindex |
1.585 |
Vlampunt |
130.3°C |
Dampdruk |
0.000806mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|