ChemNet > CAS > 87327-69-3 2-Chloro-6-fluoroacetophenone
87327-69-3 2-Chloro-6-fluoroacetophenone
| Naam product |
2-Chloro-6-fluoroacetophenone |
| Synoniemen |
1-(2-chloro-6-fluorophenyl)ethanone; 2'-Chloro-6'-fluoroacetophenone |
| MF |
C8H6ClFO |
| Molecuulgewicht |
172.584 |
| InChI |
InChI=1/C8H6ClFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
| CAS-nummer |
87327-69-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.258g/cm3 |
| Kookpunt |
191.8°C at 760 mmHg |
| Brekingsindex |
1.512 |
| Vlampunt |
69.8°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
