ChemNet > CAS > 89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
Naam product |
Methyl-2-chloro-6-methylpyrimidine-4-carboxylate |
Synoniemen |
Methyl 2-chloro-6-methylpyrimidine-4-carboxylate |
MF |
C7H7ClN2O2 |
Molecuulgewicht |
186.5957 |
InChI |
InChI=1/C7H7ClN2O2/c1-4-3-5(6(11)12-2)10-7(8)9-4/h3H,1-2H3 |
CAS-nummer |
89793-11-3 |
Moleculaire Structuur |
|
Dichtheid |
1.314g/cm3 |
Smeltpunt |
107℃ |
Kookpunt |
306.5°C at 760 mmHg |
Brekingsindex |
1.53 |
Vlampunt |
139.2°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|