ChemNet > CAS > 124312-73-8 (1-Methyl-1H-imidazol-2-yl)methylamine
124312-73-8 (1-Methyl-1H-imidazol-2-yl)methylamine
produktnavn |
(1-Methyl-1H-imidazol-2-yl)methylamine |
Engelsk navn |
(1-Methyl-1H-imidazol-2-yl)methylamine;1-(1-methyl-1H-imidazol-2-yl)methanamine; (1-Methyl-1H-imidazol-2-yl)methanamine |
Molekylær Formel |
C5H9N3 |
Molekylvekt |
111.1451 |
InChI |
InChI=1/C5H9N3/c1-8-3-2-7-5(8)4-6/h2-3H,4,6H2,1H3 |
CAS-nummer |
124312-73-8 |
Molecular Structure |
|
Tetthet |
1.16g/cm3 |
Kokepunkt |
255.1°C at 760 mmHg |
Brytningsindeks |
1.579 |
Flammepunktet |
108.1°C |
Damptrykk |
0.0166mmHg at 25°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|