ChemNet > CAS > 15219-34-8 Oxalyl bromide
15219-34-8 Oxalyl bromide
produktnavn |
Oxalyl bromide |
Synonymer |
Ethanedioyl dibromide; Ethanedioyl bromide; NSC 96957; Oxalyl bromide |
Molekylær Formel |
C2Br2O2 |
Molekylvekt |
215.8282 |
InChI |
InChI=1/C2Br2O2/c3-1(5)2(4)6 |
CAS-nummer |
15219-34-8 |
EINECS |
239-271-7 |
Molecular Structure |
|
Tetthet |
2.627g/cm3 |
Smeltepunkt |
-19℃ |
Kokepunkt |
118.3°C at 760 mmHg |
Brytningsindeks |
1.567 |
Flammepunktet |
109.8°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|