ChemNet > CAS > 220141-73-1 3,4,5-trifluoroacetophenone
220141-73-1 3,4,5-trifluoroacetophenone
produktnavn |
3,4,5-trifluoroacetophenone |
Engelsk navn |
3,4,5-trifluoroacetophenone; 3',4',5'-Trifluoroacetophenone; 1-(3,4,5-trifluorophenyl)ethanone |
Molekylær Formel |
C8H5F3O |
Molekylvekt |
174.1199 |
InChI |
InChI=1/C8H5F3O/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-3H,1H3 |
CAS-nummer |
220141-73-1 |
Molecular Structure |
|
Tetthet |
1.303g/cm3 |
Kokepunkt |
208.8°C at 760 mmHg |
Brytningsindeks |
1.455 |
Flammepunktet |
72.5°C |
Damptrykk |
0.209mmHg at 25°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|