ChemNet > CAS > 36436-65-4 2'-Hydroxy-4',5'-dimethylacetophenone
36436-65-4 2'-Hydroxy-4',5'-dimethylacetophenone
produktnavn |
2'-Hydroxy-4',5'-dimethylacetophenone |
Synonymer |
1-(2-hydroxy-4,5-dimethylphenyl)ethanone |
Molekylær Formel |
C10H12O2 |
Molekylvekt |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-6-4-9(8(3)11)10(12)5-7(6)2/h4-5,12H,1-3H3 |
CAS-nummer |
36436-65-4 |
EINECS |
253-035-0 |
Molecular Structure |
|
Tetthet |
1.08g/cm3 |
Smeltepunkt |
69-73℃ |
Kokepunkt |
274.3°C at 760 mmHg |
Brytningsindeks |
1.541 |
Flammepunktet |
114.6°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|