ChemNet > CAS > 4066-41-5 5-Acetylthiophene-2-carboxylic acid
4066-41-5 5-Acetylthiophene-2-carboxylic acid
produktnavn |
5-Acetylthiophene-2-carboxylic acid |
Synonymer |
-5-Acetyl-thiophene-2-carboxylic acid; ATC; LABOTEST-BB LT00454683; BUTTPARK 121\06-15; AKOS MSC-0226; 5-ACETYL-2-THIOPHENECARBOXYLIC ACID; RARECHEM AL BO 0535; 5-Acetylthiophene-2-CarboxylicAcid98%; 5-Acetylthiophene-2-Carboxylic Acid 98%; 5-acetylthiophene-2-carboxylate; 5-Acetyl-thiophene-2- carboxylic acid |
Molekylær Formel |
C7H6O3S |
Molekylvekt |
170.1857 |
InChI |
InChI=1/C7H6O3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3,(H,9,10) |
CAS-nummer |
4066-41-5 |
Molecular Structure |
|
Tetthet |
1.383g/cm3 |
Smeltepunkt |
204-205℃ |
Kokepunkt |
385.2°C at 760 mmHg |
Brytningsindeks |
1.591 |
Flammepunktet |
186.8°C |
Hazard symboler |
Xi:;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|