ChemNet > CAS > 94-32-6 ethyl 4-(butylamino)benzoate
94-32-6 ethyl 4-(butylamino)benzoate
produktnavn |
ethyl 4-(butylamino)benzoate |
Synonymer |
Ethyl 4-(n-butylamino)benzoate; 4-(n-Butylamino)benzoic acid ethyl ester; Ethyl-4-n-butylamino-benzoate |
Molekylær Formel |
C13H19NO2 |
Molekylvekt |
221.2955 |
InChI |
InChI=1/C13H19NO2/c1-3-5-10-14-12-8-6-11(7-9-12)13(15)16-4-2/h6-9,14H,3-5,10H2,1-2H3 |
CAS-nummer |
94-32-6 |
EINECS |
202-322-9 |
Molecular Structure |
|
Tetthet |
1.039g/cm3 |
Smeltepunkt |
68-70℃ |
Kokepunkt |
338.4°C at 760 mmHg |
Brytningsindeks |
1.534 |
Flammepunktet |
158.4°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|