ChemNet > CAS > 1548-74-9 4-amino-2,3,5,6-tetrafluorobenzamide
1548-74-9 4-amino-2,3,5,6-tetrafluorobenzamide
| Nazwa produktu: |
4-amino-2,3,5,6-tetrafluorobenzamide |
| Angielska nazwa |
4-amino-2,3,5,6-tetrafluorobenzamide; |
| MF |
C7H4F4N2O |
| Masie cząsteczkowej |
208.1131 |
| InChI |
InChI=1/C7H4F4N2O/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H2,13,14) |
| Nr CAS |
1548-74-9 |
| EINECS |
216-285-1 |
| Struktury molekularnej |
|
| Gęstość |
1.635g/cm3 |
| Temperatura topnienia |
185-186℃ |
| Temperatura wrzenia |
148.4°C at 760 mmHg |
| Współczynnik załamania |
1.531 |
| Temperatura zapłonu |
43.5°C |
| Ciśnienie pary |
4.23mmHg at 25°C |
| Symbole zagrożenia |
Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|