ChemNet > CAS > 394-29-6 5-Chloro-2-fluorobenzoyl chloride
394-29-6 5-Chloro-2-fluorobenzoyl chloride
Nazwa produktu: |
5-Chloro-2-fluorobenzoyl chloride |
Angielska nazwa |
5-Chloro-2-fluorobenzoyl chloride; 5-Chloro-2-fluorobenzyl chloride; 2-Fluoro-5-Chorobenzoyl Chloride |
MF |
C7H3Cl2FO |
Masie cząsteczkowej |
193.0025 |
InChI |
InChI=1/C7H3Cl2FO/c8-4-1-2-6(10)5(3-4)7(9)11/h1-3H |
Nr CAS |
394-29-6 |
Struktury molekularnej |
|
Gęstość |
1.462g/cm3 |
Temperatura wrzenia |
213°C at 760 mmHg |
Współczynnik załamania |
1.539 |
Temperatura zapłonu |
82.6°C |
Ciśnienie pary |
0.168mmHg at 25°C |
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|