1527-91-9 N-Phenylbenzamidine
| Nome do produto |
N-Phenylbenzamidine |
| Nome em inglês |
N-Phenylbenzamidine; N1-Phenylbenzene-1-carboximidamide; N'-phenylbenzenecarboximidamide; N-[(1Z)-amino(phenyl)methylidene]anilinium |
| Fórmula molecular |
C13H13N2 |
| Peso Molecular |
197.2552 |
| InChI |
InChI=1/C13H12N2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H,(H2,14,15)/p+1 |
| CAS Registry Number |
1527-91-9 |
| EINECS |
210-720-9 |
| Estrutura Molecular |
|
| Ponto de fusão |
118-120℃ |
| Ponto de ebulição |
346.3°C at 760 mmHg |
| O ponto de inflamação |
163.3°C |
| Pressão de vapor |
5.8E-05mmHg at 25°C |
| Símbolos de perigo |
Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|