ChemNet > CAS > 202925-04-0 2-Chloro-1,5-dibromo-3-fluorobenzene
202925-04-0 2-Chloro-1,5-dibromo-3-fluorobenzene
Nome do produto |
2-Chloro-1,5-dibromo-3-fluorobenzene |
Nome em inglês |
2-Chloro-1,5-dibromo-3-fluorobenzene; 2-Chloro-3,5-dibromo-1-fluorobenzene; 1,5-Dibromo-2-chloro-3-fluorobenzene; 1,5-Dibromo-2-chloro-3-fluorobenzene |
Fórmula molecular |
C6H2Br2ClF |
Peso Molecular |
288.34 |
InChI |
InChI:1S/C6H2Br2ClF/c7-3-1-4(8)6(9)5(10)2-3/h1-2H |
CAS Registry Number |
202925-04-0 |
Estrutura Molecular |
|
Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|