ChemNet > CAS > 4411-26-1 1-Adamantyl isothiocyanate
4411-26-1 1-Adamantyl isothiocyanate
| Название продукта |
1-Adamantyl isothiocyanate |
| Синонимы |
tricyclo(3.3.1.13,7)dec-1-yl isocyanate; Isothiocyanic acid 1-adamantyl estr; 1-isothiocyanatotricyclo[3.3.1.1~3,7~]decane |
| Молекулярная формула |
C11H15NS |
| Молекулярный вес |
193.3085 |
| InChI |
InChI=1/C11H15NS/c13-7-12-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-6H2 |
| Регистрационный номер CAS |
4411-26-1 |
| EINECS |
224-564-4 |
| Молекулярная структура |
|
| Плотность |
1.35g/cm3 |
| Температура плавления |
166-168℃ |
| Точка кипения |
297.6°C at 760 mmHg |
| Показатель преломления |
1.721 |
| Температура вспышки |
138°C |
| Символы опасности |
 Xn:Harmful;
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
