1135-12-2 4-Aminodiphenylmethane
اسم المنتج |
4-Aminodiphenylmethane |
الاسم بالانجليزية |
4-Aminodiphenylmethane; 4-Benzylaniline; 1,1,2,2-tetramethyl-3,4-di(propan-2-ylidene)cyclobutane |
الصيغة الجزيئية |
C13H13N |
الوزن الجزيئي الغرامي |
183.249 |
InChI |
InChI=1/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
إستراتيجية المساعدة القطرية |
1135-12-2 |
بنية جزيئية |
|
كثافة |
1.07g/cm3 |
نقطة الغليان |
300°C at 760 mmHg |
معامل الإنكسار |
1.616 |
نقطة الوميض |
159.5°C |
ضغط البخار |
0.00115mmHg at 25°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|