ChemNet > CAS > 137-97-3 1,3-di-O-tolyl-2-thiourea
137-97-3 1,3-di-O-tolyl-2-thiourea
اسم المنتج |
1,3-di-O-tolyl-2-thiourea |
الاسم بالانجليزية |
1,3-di-O-tolyl-2-thiourea; Ditolylthiourea; N,N-Di-o-tolylthiourea; N,N-Bis(2-Methylphenyl)thiourea; N,N,N-trimethyl(phenyl)methanaminium bromide; 1,3-bis(2-methylphenyl)thiourea |
الصيغة الجزيئية |
C15H16N2S |
الوزن الجزيئي الغرامي |
256.3659 |
InChI |
InChI=1/C15H16N2S/c1-11-7-3-5-9-13(11)16-15(18)17-14-10-6-4-8-12(14)2/h3-10H,1-2H3,(H2,16,17,18) |
إستراتيجية المساعدة القطرية |
137-97-3 |
المفوضية الأوروبية رقم |
205-309-6 |
بنية جزيئية |
|
كثافة |
1.219g/cm3 |
درجة الإنصهار |
157-159℃ |
نقطة الغليان |
367.5°C at 760 mmHg |
معامل الإنكسار |
1.707 |
نقطة الوميض |
176°C |
ضغط البخار |
1.36E-05mmHg at 25°C |
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|