ChemNet > CAS > 189807-20-3 2,3,6-trifluorobenzoyl chloride
189807-20-3 2,3,6-trifluorobenzoyl chloride
اسم المنتج |
2,3,6-trifluorobenzoyl chloride |
الاسم بالانجليزية |
2,3,6-trifluorobenzoyl chloride; Trifluorobenzoylchloride |
الصيغة الجزيئية |
C7H2ClF3O |
الوزن الجزيئي الغرامي |
194.5384 |
InChI |
InChI=1/C7H2ClF3O/c8-7(12)5-3(9)1-2-4(10)6(5)11/h1-2H |
إستراتيجية المساعدة القطرية |
189807-20-3 |
بنية جزيئية |
|
كثافة |
1.514g/cm3 |
نقطة الغليان |
180.1°C at 760 mmHg |
معامل الإنكسار |
1.479 |
نقطة الوميض |
59°C |
ضغط البخار |
0.913mmHg at 25°C |
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|