ChemNet > CAS > 220497-68-7 (S)-N-FMOC-3-Amino-3-(4-bromophenyl)propanoic acid
220497-68-7 (S)-N-FMOC-3-Amino-3-(4-bromophenyl)propanoic acid
اسم المنتج |
(S)-N-FMOC-3-Amino-3-(4-bromophenyl)propanoic acid |
الاسم بالانجليزية |
(S)-N-FMOC-3-Amino-3-(4-bromophenyl)propanoic acid; Fmoc-3-S-4-Bromophenylalanine; Fmoc-(S)-3-Amino-3-(4-bromophenyl)-propionic acid; Fmoc-(S)-3-Amino-3-(4-Bromo-Phenyl)-Propionic Acid |
الصيغة الجزيئية |
C24H19BrNO4 |
الوزن الجزيئي الغرامي |
465.3165 |
InChI |
InChI=1/C24H20BrNO4/c25-16-11-9-15(10-12-16)22(13-23(27)28)26-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)/p-1/t22-/m0/s1 |
إستراتيجية المساعدة القطرية |
220497-68-7 |
بنية جزيئية |
|
درجة الإنصهار |
188.6℃ |
نقطة الغليان |
664.4°C at 760 mmHg |
نقطة الوميض |
355.6°C |
ضغط البخار |
1.47E-18mmHg at 25°C |
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|