ChemNet > CAS > 32890-90-7 6-Chloro-2-fluoro-3-methylbenzoic acid
32890-90-7 6-Chloro-2-fluoro-3-methylbenzoic acid
| اسم المنتج |
6-Chloro-2-fluoro-3-methylbenzoic acid |
| الاسم المستعار |
6-Chloro-2-fluoro-m-toluic acid |
| الصيغة الجزيئية |
C8H6ClFO2 |
| الوزن الجزيئي الغرامي |
188.5834 |
| InChI |
InChI=1/C8H6ClFO2/c1-4-2-3-5(9)6(7(4)10)8(11)12/h2-3H,1H3,(H,11,12) |
| إستراتيجية المساعدة القطرية |
32890-90-7 |
| بنية جزيئية |
|
| كثافة |
1.403g/cm3 |
| نقطة الغليان |
279.7°C at 760 mmHg |
| معامل الإنكسار |
1.551 |
| نقطة الوميض |
123°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
