ChemNet > CAS > 402-63-1 1-(3-fluorophenyl)ethanol
402-63-1 1-(3-fluorophenyl)ethanol
اسم المنتج |
1-(3-fluorophenyl)ethanol |
الاسم بالانجليزية |
1-(3-fluorophenyl)ethanol; 3-fluorophenyl methyl carbinol; 3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol; 3-Fluoro-α-methylbenzenemethanol |
الصيغة الجزيئية |
C8H9FO |
الوزن الجزيئي الغرامي |
140.1549 |
InChI |
InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
إستراتيجية المساعدة القطرية |
402-63-1 |
المفوضية الأوروبية رقم |
206-950-4 |
بنية جزيئية |
|
كثافة |
1.123g/cm3 |
نقطة الغليان |
196.2°C at 760 mmHg |
معامل الإنكسار |
1.51 |
نقطة الوميض |
90.1°C |
ضغط البخار |
0.251mmHg at 25°C |
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|