ChemNet > CAS > 579-39-5 4,4'-Difluorobenzil
579-39-5 4,4'-Difluorobenzil
اسم المنتج |
4,4'-Difluorobenzil |
الاسم المستعار |
4,4-Difluorodibenzoyl; 4,4-Fluorobenzil; 1,2-bis(4-fluorophenyl)ethane-1,2-dione |
الصيغة الجزيئية |
C14H8F2O2 |
الوزن الجزيئي الغرامي |
246.2089 |
InChI |
InChI=1/C14H8F2O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8H |
إستراتيجية المساعدة القطرية |
579-39-5 |
بنية جزيئية |
|
كثافة |
1.304g/cm3 |
درجة الإنصهار |
119-122℃ |
نقطة الغليان |
370.2°C at 760 mmHg |
معامل الإنكسار |
1.562 |
نقطة الوميض |
141.5°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|