ChemNet > CAS > 93413-76-4 Intermediate of Venlafaxine
93413-76-4 Intermediate of Venlafaxine
| اسم المنتج |
Intermediate of Venlafaxine |
| الاسم المستعار |
1-(cyclohexanol)-(4methoxyphenyl)acetonitrile; 1-[Cyano(4-methoxyphenyl)methyl]cyclohexanol; 1-[Cyano-(p-methoxyphenyl)methyl]cyclohexanol; (1-hydroxycyclohexyl)(4-methoxyphenyl)acetonitrile; 1-[(1-Cyano)-1-(4-methoxyphenyl)methyl cyclohexanol; 1-[2-amlno-1-(4-methoxyphenyl)ethyl]cyciohexanol; 1-Cyano-(4-methoxyphenyl)methyl cyclohexanol |
| الصيغة الجزيئية |
C15H19NO2 |
| الوزن الجزيئي الغرامي |
245.3169 |
| InChI |
InChI=1/C15H19NO2/c1-18-13-7-5-12(6-8-13)14(11-16)15(17)9-3-2-4-10-15/h5-8,14,17H,2-4,9-10H2,1H3 |
| إستراتيجية المساعدة القطرية |
93413-76-4 |
| بنية جزيئية |
|
| كثافة |
1.142g/cm3 |
| درجة الإنصهار |
121-123°C |
| نقطة الغليان |
410.146°C at 760 mmHg |
| معامل الإنكسار |
1.561 |
| نقطة الوميض |
201.849°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
|
|
