ChemNet > CAS > 216393-55-4 Methyl 3,5-difluorobenzoate
216393-55-4 Methyl 3,5-difluorobenzoate
| Ürün Adı |
Methyl 3,5-difluorobenzoate |
| Eş anlamlı |
3,5-Difluorobenzoic acid methyl ester |
| Moleküler Formülü |
C8H6F2O2 |
| Molekül Ağırlığı |
172.1288 |
| InChI |
InChI=1/C8H6F2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 |
| CAS kayıt numarası |
216393-55-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.268g/cm3 |
| Kaynama noktası |
202.7°C at 760 mmHg |
| Kırılma indisi |
1.472 |
| Alevlenme noktası |
74.6°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
