ChemNet > CAS > 589-91-3 4-Methylcyclohexanol, mixture of cis and trans
589-91-3 4-Methylcyclohexanol, mixture of cis and trans
Ürün Adı |
4-Methylcyclohexanol, mixture of cis and trans |
Eş anlamlı |
4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
Moleküler Formülü |
C7H14O |
Molekül Ağırlığı |
114.1855 |
InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
CAS kayıt numarası |
589-91-3 |
EINECS |
209-664-8 |
Moleküler Yapısı |
|
Yoğunluk |
0.925g/cm3 |
Ergime noktası |
-41℃ |
Kaynama noktası |
170.322°C at 760 mmHg |
Kırılma indisi |
1.463 |
Alevlenme noktası |
70°C |
Suda çözünürlük |
slightly soluble |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:;
|
|