5239-82-7 Cyclopropylacetic acid
| product Name |
Cyclopropylacetic acid |
| CAS No |
5239-82-7 |
| Synonyms |
Cyclopropaneacetic acid; N,N'-lambda~4~-sulfanediylidenebis(1,3-dimethyl-1,3,2-diazaborolidin-2-amine); 2-cyclopropylacetic acid |
| Molecular Formula |
C8H20B2N6S |
| Molecular Weight |
253.9716 |
| InChI |
InChI=1/C8H20B2N6S/c1-13-5-6-14(2)9(13)11-17-12-10-15(3)7-8-16(10)4/h5-8H2,1-4H3 |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Boiling point |
293°C at 760 mmHg |
| Refractive index |
1.584 |
| Flash point |
131°C |
| Vapour Pressur |
0.00177mmHg at 25°C |
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Telephone |
+86-21-61066956/57/58£¬61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |
| Contact |
Mr Chen Wei-dong |
| Telephone |
+86-21-64251386 |
| Email |
wdchen@shwychem.com |
| Address |
HQ in Shanghai: 4st Floor S&T Industry Building, 130 Meilong Road, Shanghai200237,China |
| Telephone |
+86-21-54450828,+86-13501997194 |
| Email |
coco.yang@fwdchem.com |
| Address |
Room 802,Lotus Tower ,159 Tianzhou Road, Xuhui District,Shanghai 200233 ,P.R.China |