4712-55-4 Diphenyl phosphite
| نام محصول |
Diphenyl phosphite |
| نام انگلیسی |
Diphenyl phosphite; diphenyl phosphonate; Phosphonic acid diphenyl ester; diphenyl hydrogen phosphite; oxo(diphenoxy)phosphonium |
| میدان مغناطیسی |
C12H11O3P |
| وزن مولکولی |
234.1877 |
| InChI |
InChI=1/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
| شماره سیایاس |
4712-55-4 |
| تعداد کمیسیون اروپایی |
225-202-8 |
| ساختار مولکولی |
|
| نقطه ذوب |
12℃ |
| نقطه غلیان |
348.233°C at 760 mmHg |
| نقطه اشتعال |
178.834°C |
| فشار بخار |
0mmHg at 25°C |
| خطر نمادها |
C:Corrosive;
|
| کدهای خطر |
R34:Causes burns.;
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|