ChemNet > CAS > 359-37-5 iodotrifluoroethylene
359-37-5 iodotrifluoroethylene
| اسم المنتج |
iodotrifluoroethylene |
| الاسم المستعار |
Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
| الصيغة الجزيئية |
C2F3I |
| الوزن الجزيئي الغرامي |
207.9211 |
| InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
| إستراتيجية المساعدة القطرية |
359-37-5 |
| المفوضية الأوروبية رقم |
206-629-9 |
| بنية جزيئية |
|
| كثافة |
2.311g/cm3 |
| نقطة الغليان |
30°C at 760 mmHg |
| معامل الإنكسار |
1.457 |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
