Details for 2-Furfurylthio-3-methylpyrazine
2-Furfurylthio-3-methylpyrazine
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
65530-53-2 |
| EC NO: |
|
| Molecular Formula: |
C10H10N2OS |
| Molecular Weight: |
206.26 |
| Specification: |
|
| InChI: |
InChI=1/C10H10N2OS/c1-4-13-6-9(1)7-14-8-10-5-11-2-3-12-10/h1-6H,7-8H2 |
Product description:
| Appearance |
Odor |
Application |
| Amber liquid |
Roast Aroma of Nuts, Coffee, Seasemes |
Nut Products: Roast Coffee, Sesames |
|
| Synonyms: |
2-Furfurylthio-3-methyl pyrazine;2-Methyl-3(5/6)(furfurylthio)pyrazine; |
| Molecular Structure: |
 |
if you are sourcing 2-Furfurylthio-3-methylpyrazine from China ,just feel free to inquire
CN
China Suppliers > tzrunlong > 
Search Product