ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
| název výrobku |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
| Anglický název |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane; |
| Molekulární vzorec |
C7H11FO2 |
| Molekulová hmotnost |
146.1594 |
| InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
| Registrační číslo CAS |
1171-47-7 |
| Molekulární struktura |
|
| Hustota |
1.159g/cm3 |
| Bod varu |
227.566°C at 760 mmHg |
| Index lomu |
1.454 |
| Bod vzplanutí |
91.429°C |
| Tlak par |
0.028mmHg at 25°C |
| Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|