ChemNet > CAS > 84777-06-0 1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear
84777-06-0 1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear
název výrobku |
1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear |
Anglický název |
1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear; Diisopentylphthalate; Dipentyl phthalate,branched and linear; 3,4-diisopentylphthalate; 3,4-bis(3-methylbutyl)benzene-1,2-dicarboxylate |
Molekulární vzorec |
C18H24O4 |
Molekulová hmotnost |
304.3819 |
InChI |
InChI=1/C18H26O4/c1-11(2)5-7-13-8-10-15(17(19)20)16(18(21)22)14(13)9-6-12(3)4/h8,10-12H,5-7,9H2,1-4H3,(H,19,20)(H,21,22)/p-2 |
Registrační číslo CAS |
84777-06-0 |
EINECS |
284-032-2 |
Molekulární struktura |
|
Bod varu |
439.4°C at 760 mmHg |
Bod vzplanutí |
233.7°C |
Tlak par |
1.69E-08mmHg at 25°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
|
Bezpečnostní Popis |
|
|