ChemNet > CAS > 84777-06-0 1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear
84777-06-0 1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear
Nazwa produktu: |
1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear |
Angielska nazwa |
1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear; Diisopentylphthalate; Dipentyl phthalate,branched and linear; 3,4-diisopentylphthalate; 3,4-bis(3-methylbutyl)benzene-1,2-dicarboxylate |
MF |
C18H24O4 |
Masie cząsteczkowej |
304.3819 |
InChI |
InChI=1/C18H26O4/c1-11(2)5-7-13-8-10-15(17(19)20)16(18(21)22)14(13)9-6-12(3)4/h8,10-12H,5-7,9H2,1-4H3,(H,19,20)(H,21,22)/p-2 |
Nr CAS |
84777-06-0 |
EINECS |
284-032-2 |
Struktury molekularnej |
|
Temperatura wrzenia |
439.4°C at 760 mmHg |
Temperatura zapłonu |
233.7°C |
Ciśnienie pary |
1.69E-08mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
|
|