2307-10-0 S-n-Propyl thioacetate
Produkt-Name |
S-n-Propyl thioacetate |
Englischer Name |
S-n-Propyl thioacetate; Thioacetic acid S-n-propyl ester; S-propyl ethanethioate; Propyl thioacetate |
Molekulare Formel |
C5H10OS |
Molecular Weight |
118.1973 |
InChI |
InChI=1/C5H10OS/c1-3-4-7-5(2)6/h3-4H2,1-2H3 |
CAS Registry Number |
2307-10-0 |
EINECS |
218-984-7 |
Molecular Structure |
|
Dichte |
0.967g/cm3 |
Siedepunkt |
141.4°C at 760 mmHg |
Brechungsindex |
1.456 |
Flammpunkt |
36°C |
Dampfdruck |
5.87mmHg at 25°C |
Risk Codes |
R10:Flammable.;
|
Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|