ChemNet > CAS > 3988-03-2 4,4'-dibromobenzophenone
3988-03-2 4,4'-dibromobenzophenone
| Produkt-Name |
4,4'-dibromobenzophenone |
| Synonyme |
Bis(p-bromophenyl) ketone; NSC 86518; p,p'-Dibromobenzophenone; Benzophenone, 4,4'-dibromo- (8CI); Methanone, bis(4-bromophenyl)- (9CI); bis(4-bromophenyl)methanone |
| Molekulare Formel |
C13H8Br2O |
| Molecular Weight |
340.01 |
| InChI |
InChI=1/C13H8Br2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
| CAS Registry Number |
3988-03-2 |
| EINECS |
223-632-0 |
| Molecular Structure |
|
| Dichte |
1.7g/cm3 |
| Schmelzpunkt |
171-174℃ |
| Siedepunkt |
395.6°C at 760 mmHg |
| Brechungsindex |
1.633 |
| Flammpunkt |
121°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S22:;
S24/25:;
|
|
