610-96-8 Methyl 2-chlorobenzoate
| Produkt-Name |
Methyl 2-chlorobenzoate |
| Englischer Name |
Methyl 2-chlorobenzoate; Chlorobenzoic acid methyl ester; O-Chlorobenzoic Acid Methyl Ester; 2-Chlorobenzoic Acid Methyl Ester |
| Molekulare Formel |
C8H7ClO2 |
| Molecular Weight |
170.593 |
| InChI |
InChI=1/C8H7ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| CAS Registry Number |
610-96-8 |
| EINECS |
210-242-0 |
| Molecular Structure |
|
| Dichte |
1.224g/cm3 |
| Siedepunkt |
225.4°C at 760 mmHg |
| Brechungsindex |
1.528 |
| Flammpunkt |
101.7°C |
| Dampfdruck |
0.0868mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|