610-96-8 Methyl 2-chlorobenzoate
| Naam product |
Methyl 2-chlorobenzoate |
| Engelse naam |
Methyl 2-chlorobenzoate; Chlorobenzoic acid methyl ester; O-Chlorobenzoic Acid Methyl Ester; 2-Chlorobenzoic Acid Methyl Ester |
| MF |
C8H7ClO2 |
| Molecuulgewicht |
170.593 |
| InChI |
InChI=1/C8H7ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| CAS-nummer |
610-96-8 |
| EINECS |
210-242-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.224g/cm3 |
| Kookpunt |
225.4°C at 760 mmHg |
| Brekingsindex |
1.528 |
| Vlampunt |
101.7°C |
| Dampdruk |
0.0868mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|