ChemNet > CAS > 615-94-1 2,5-Dihydroxy-1,4-benzoquinone
615-94-1 2,5-Dihydroxy-1,4-benzoquinone
| Produkt-Name |
2,5-Dihydroxy-1,4-benzoquinone |
| Synonyme |
2,5-Dihydroxybenzoquinone; 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| Molekulare Formel |
C6H4O4 |
| Molecular Weight |
140.0936 |
| InChI |
InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
| CAS Registry Number |
615-94-1 |
| EINECS |
210-454-3 |
| Molecular Structure |
|
| Dichte |
1.843g/cm3 |
| Schmelzpunkt |
220℃ |
| Siedepunkt |
322.3°C at 760 mmHg |
| Brechungsindex |
1.729 |
| Flammpunkt |
162.9°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|
