ChemNet > CAS > 5467-72-1 4-Bromophenacylamine hydrochloride
5467-72-1 4-Bromophenacylamine hydrochloride
| product Name |
4-Bromophenacylamine hydrochloride |
| CAS No |
5467-72-1 |
| Synonyms |
2-Amino-4'-Bromoacetophenone Hydrochloride; 2-Amino-4'-bromoacetophenone HCl |
| Molecular Formula |
C8H8BrNO |
| Molecular Weight |
214.0592 |
| InChI |
InChI=1/C8H8BrNO/c9-7-3-1-6(2-4-7)8(11)5-10/h1-4H,5,10H2 |
| EINECS |
226-778-3 |
| Molecular Structure |
|
| Density |
1.52g/cm3 |
| Melting point |
265℃ |
| Boiling point |
322.8°C at 760 mmHg |
| Refractive index |
1.589 |
| Flash point |
149°C |
| Vapour Pressur |
0.000272mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|